C12H13NO4S — CID 169408237
2-[(3S)-5-ethyl-3-hydroxy-2-oxo-3-sulfanylindol-1-yl]acetic acid (PubChem CID 169408237) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[(3S)-5-ethyl-3-hydroxy-2-oxo-3-sulfanylindol-1-yl]acetic acid.
| Compound Name | 2-[(3S)-5-ethyl-3-hydroxy-2-oxo-3-sulfanylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 169408237 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[(3S)-5-ethyl-3-hydroxy-2-oxo-3-sulfanylindol-1-yl]acetic acid |
| SMILES | CCc1ccc2c(c1)[C@](O)(S)C(=O)N2CC(=O)O |
| InChI | InChI=1S/C12H13NO4S/c1-2-7-3-4-9-8(5-7)12(17,18)11(16)13(9)6-10(14)15/h3-5,17-18H,2,6H2,1H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | HPGCTAUGQABACI-LBPRGKRZSA-N |
| XLogP | 0.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|