C11H16O2 — CID 169408887
(3aS,7aS)-3a-propan-2-yl-3,4,5,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 169408887) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3aS,7aS)-3a-propan-2-yl-3,4,5,7a-tetrahydro-1-benzofuran-2-one.
| Compound Name | (3aS,7aS)-3a-propan-2-yl-3,4,5,7a-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 169408887 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3aS,7aS)-3a-propan-2-yl-3,4,5,7a-tetrahydro-1-benzofuran-2-one |
| SMILES | CC(C)[C@@]12CCC=C[C@@H]1OC(=O)C2 |
| InChI | InChI=1S/C11H16O2/c1-8(2)11-6-4-3-5-9(11)13-10(12)7-11/h3,5,8-9H,4,6-7H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | AVVHOPHYULQCTD-ONGXEEELSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|