C11H16N2O5 — CID 169409392
(2S,6S)-2,6-diamino-2-but-2-ynyl-3-oxoheptanedioic acid (PubChem CID 169409392) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S,6S)-2,6-diamino-2-but-2-ynyl-3-oxoheptanedioic acid.
| Compound Name | (2S,6S)-2,6-diamino-2-but-2-ynyl-3-oxoheptanedioic acid |
|---|---|
| PubChem CID | 169409392 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S,6S)-2,6-diamino-2-but-2-ynyl-3-oxoheptanedioic acid |
| SMILES | CC#CC[C@@](N)(C(=O)O)C(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c1-2-3-6-11(13,10(17)18)8(14)5-4-7(12)9(15)16/h7H,4-6,12-13H2,1H3,(H,15,16)(H,17,18)/t7-,11-/m0/s1 |
| InChIKey | LEQASKRNMKVODG-CPCISQLKSA-N |
| XLogP | -1.06 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|