C23H27NO2 — CID 169409558
(5R,8S,8aS)-5-[3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one (PubChem CID 169409558) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (5R,8S,8aS)-5-[3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one.
| Compound Name | (5R,8S,8aS)-5-[3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 169409558 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (5R,8S,8aS)-5-[3-(1,3-dihydroisoindol-2-yl)-3-oxoprop-1-en-2-yl]-3,8-dimethyl-4,5,6,7,8,8a-hexahydro-1H-azulen-2-one |
| SMILES | C=C(C(=O)N1Cc2ccccc2C1)[C@@H]1CC[C@H](C)[C@@H]2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C23H27NO2/c1-14-8-9-17(10-21-16(3)22(25)11-20(14)21)15(2)23(26)24-12-18-6-4-5-7-19(18)13-24/h4-7,14,17,20H,2,8-13H2,1,3H3/t14-,17+,20-/m0/s1 |
| InChIKey | HXEUAQDNBYITLP-NQYLQCIDSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|