C19H24N4O2 — CID 169411104
N-[(4aR,6S,7aS)-2-(6-methylpyridazin-3-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methylfuran-2-carboxamide (PubChem CID 169411104) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[(4aR,6S,7aS)-2-(6-methylpyridazin-3-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[(4aR,6S,7aS)-2-(6-methylpyridazin-3-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 169411104 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[(4aR,6S,7aS)-2-(6-methylpyridazin-3-yl)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(N2CC[C@@H]3C[C@H](N(C)C(=O)c4ccco4)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-5-6-18(21-20-13)23-8-7-14-10-16(11-15(14)12-23)22(2)19(24)17-4-3-9-25-17/h3-6,9,14-16H,7-8,10-12H2,1-2H3/t14-,15-,16+/m1/s1 |
| InChIKey | LGZHHNYSXITHEA-OAGGEKHMSA-N |
| XLogP | 2.76 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |