C29H28N4O5S — CID 169411163
3-(2-amino-1,3-benzothiazole-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one (PubChem CID 169411163) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is 3-(2-amino-1,3-benzothiazole-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one.
| Compound Name | 3-(2-amino-1,3-benzothiazole-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one |
|---|---|
| PubChem CID | 169411163 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 3-(2-amino-1,3-benzothiazole-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one |
| SMILES | COc1cc2c3cc1OCC(=O)NCCCOc1cccc(c1)C2N(C(=O)c1ccc2sc(N)nc2c1)CC3 |
| InChI | InChI=1S/C29H28N4O5S/c1-36-23-15-21-17-8-10-33(28(35)19-6-7-25-22(13-19)32-29(30)39-25)27(21)18-4-2-5-20(12-18)37-11-3-9-31-26(34)16-38-24(23)14-17/h2,4-7,12-15,27H,3,8-11,16H2,1H3,(H2,30,32)(H,31,34) |
| InChIKey | VXVSTHOFBVFDPN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |