C30H30N2O6 — CID 170509259
3-(2,3-dihydro-1-benzofuran-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one (PubChem CID 170509259) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one |
|---|---|
| PubChem CID | 170509259 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-carbonyl)-9-methoxy-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6(24),7,9,19,21-hexaen-13-one |
| SMILES | COc1cc2c3cc1OCC(=O)NCCCOc1cccc(c1)C2N(C(=O)c1ccc2c(c1)CCO2)CC3 |
| InChI | InChI=1S/C30H30N2O6/c1-35-26-17-24-19-8-11-32(30(34)22-6-7-25-20(14-22)9-13-37-25)29(24)21-4-2-5-23(15-21)36-12-3-10-31-28(33)18-38-27(26)16-19/h2,4-7,14-17,29H,3,8-13,18H2,1H3,(H,31,33) |
| InChIKey | ILDLKUDFSJFKHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |