C22H18ClFN2O2 — CID 169418590
2-chloro-5-[3-fluoro-5-[(2-methylphenyl)carbamoyl]phenyl]-N-methylbenzamide (PubChem CID 169418590) has the molecular formula C22H18ClFN2O2 and a molecular weight of 396.85 g/mol. Its IUPAC name is 2-chloro-5-[3-fluoro-5-[(2-methylphenyl)carbamoyl]phenyl]-N-methylbenzamide.
| Compound Name | 2-chloro-5-[3-fluoro-5-[(2-methylphenyl)carbamoyl]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 169418590 |
| Molecular Formula | C22H18ClFN2O2 |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-chloro-5-[3-fluoro-5-[(2-methylphenyl)carbamoyl]phenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(-c2cc(F)cc(C(=O)Nc3ccccc3C)c2)ccc1Cl |
| InChI | InChI=1S/C22H18ClFN2O2/c1-13-5-3-4-6-20(13)26-21(27)16-9-15(10-17(24)11-16)14-7-8-19(23)18(12-14)22(28)25-2/h3-12H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | DFTZYEGLWPSYQG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |