C20H29ClN2O5 — CID 169418932
1-[(3aS,6aS)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone (PubChem CID 169418932) has the molecular formula C20H29ClN2O5 and a molecular weight of 412.91 g/mol. Its IUPAC name is 1-[(3aS,6aS)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3aS,6aS)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 169418932 |
| Molecular Formula | C20H29ClN2O5 |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[(3aS,6aS)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-3a-(hydroxymethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1C[C@@H]2CN(Cc3cc(Cl)cc(OC)c3OC)C[C@]2(CO)C1 |
| InChI | InChI=1S/C20H29ClN2O5/c1-4-28-10-18(25)23-9-15-8-22(11-20(15,12-23)13-24)7-14-5-16(21)6-17(26-2)19(14)27-3/h5-6,15,24H,4,7-13H2,1-3H3/t15-,20+/m0/s1 |
| InChIKey | AEXIUJOPMHHYTP-MGPUTAFESA-N |
| XLogP | 1.65 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |