C17H20ClFN2O4 — CID 133132108
(3aR,6aR)-2-[(3-chloro-5-fluorophenyl)methyl]-5-(2-methoxyacetyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133132108) has the molecular formula C17H20ClFN2O4 and a molecular weight of 370.81 g/mol. Its IUPAC name is (3aR,6aR)-2-[(3-chloro-5-fluorophenyl)methyl]-5-(2-methoxyacetyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-[(3-chloro-5-fluorophenyl)methyl]-5-(2-methoxyacetyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133132108 |
| Molecular Formula | C17H20ClFN2O4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (3aR,6aR)-2-[(3-chloro-5-fluorophenyl)methyl]-5-(2-methoxyacetyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | COCC(=O)N1C[C@H]2CN(Cc3cc(F)cc(Cl)c3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H20ClFN2O4/c1-25-8-15(22)21-7-12-6-20(9-17(12,10-21)16(23)24)5-11-2-13(18)4-14(19)3-11/h2-4,12H,5-10H2,1H3,(H,23,24)/t12-,17-/m1/s1 |
| InChIKey | SZYBLOMTZXZYCX-SJKOYZFVSA-N |
| XLogP | 1.47 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |