C17H22ClFN2O3 — CID 72931217
(3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72931217) has the molecular formula C17H22ClFN2O3 and a molecular weight of 356.83 g/mol. Its IUPAC name is (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72931217 |
| Molecular Formula | C17H22ClFN2O3 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (3aS,6aS)-5-[(4-chloro-3-fluorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | COCCN1C[C@@H]2CN(Cc3ccc(Cl)c(F)c3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H22ClFN2O3/c1-24-5-4-20-8-13-9-21(11-17(13,10-20)16(22)23)7-12-2-3-14(18)15(19)6-12/h2-3,6,13H,4-5,7-11H2,1H3,(H,22,23)/t13-,17-/m1/s1 |
| InChIKey | RQYNOXCVHVFVHG-CXAGYDPISA-N |
| XLogP | 1.94 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |