C17H23ClN2O3 — CID 133116768
(3aR,6aR)-5-[(4-chlorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133116768) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is (3aR,6aR)-5-[(4-chlorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(4-chlorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133116768 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3aR,6aR)-5-[(4-chlorophenyl)methyl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | COCCN1C[C@H]2CN(Cc3ccc(Cl)cc3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-23-7-6-19-9-14-10-20(12-17(14,11-19)16(21)22)8-13-2-4-15(18)5-3-13/h2-5,14H,6-12H2,1H3,(H,21,22)/t14-,17-/m0/s1 |
| InChIKey | KYLXZECFFOVJLC-YOEHRIQHSA-N |
| XLogP | 1.80 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |