C18H25ClN2O5 — CID 72880603
(3aS,6aS)-5-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72880603) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is (3aS,6aS)-5-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72880603 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3aS,6aS)-5-[(3-chloro-4,5-dimethoxyphenyl)methyl]-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | COc1cc(CN2C[C@H]3CN(CCO)C[C@@]3(C(=O)O)C2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H25ClN2O5/c1-25-15-6-12(5-14(19)16(15)26-2)7-21-9-13-8-20(3-4-22)10-18(13,11-21)17(23)24/h5-6,13,22H,3-4,7-11H2,1-2H3,(H,23,24)/t13-,18-/m1/s1 |
| InChIKey | FPPSCUXYUPXCJK-FZKQIMNGSA-N |
| XLogP | 1.17 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |