C36H47NO9 — CID 169423597
(20E)-23-amino-4,10,12,14,16-pentahydroxy-3,9,11,13,15,17,21,25-octamethyltricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaene-6,22,26,28-tetrone (PubChem CID 169423597) has the molecular formula C36H47NO9 and a molecular weight of 637.77 g/mol. Its IUPAC name is (20E)-23-amino-4,10,12,14,16-pentahydroxy-3,9,11,13,15,17,21,25-octamethyltricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaene-6,22,26,28-tetrone.
| Compound Name | (20E)-23-amino-4,10,12,14,16-pentahydroxy-3,9,11,13,15,17,21,25-octamethyltricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaene-6,22,26,28-tetrone |
|---|---|
| PubChem CID | 169423597 |
| Molecular Formula | C36H47NO9 |
| Molecular Weight | 637.77 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | (20E)-23-amino-4,10,12,14,16-pentahydroxy-3,9,11,13,15,17,21,25-octamethyltricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaene-6,22,26,28-tetrone |
| SMILES | CC1=C2C(=O)c3cc(C)c(O)c(c3C1=O)C(=O)C=CC(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=C/C=C(/C)C(=O)C2N |
| InChI | InChI=1S/C36H47NO9/c1-15-10-9-11-16(2)32(42)28(37)25-19(5)35(45)26-23(36(25)46)14-18(4)31(41)27(26)24(38)13-12-17(3)30(40)21(7)34(44)22(8)33(43)20(6)29(15)39/h9-15,17,20-22,28-30,33-34,39-41,43-44H,37H2,1-8H3/b10-9?,13-12?,16-11- |
| InChIKey | URLZECPHBHNBNP-FRGVINCESA-N |
| XLogP | 3.17 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|