C34H28Br2F2N2O5 — CID 169424524
4-bromo-2-fluorobenzaldehyde;methyl (E)-3-(3-aminophenyl)prop-2-enoate;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]phenyl]prop-2-enoate (PubChem CID 169424524) has the molecular formula C34H28Br2F2N2O5 and a molecular weight of 742.41 g/mol. Its IUPAC name is 4-bromo-2-fluorobenzaldehyde;methyl (E)-3-(3-aminophenyl)prop-2-enoate;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]phenyl]prop-2-enoate.
| Compound Name | 4-bromo-2-fluorobenzaldehyde;methyl (E)-3-(3-aminophenyl)prop-2-enoate;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 169424524 |
| Molecular Formula | C34H28Br2F2N2O5 |
| Molecular Weight | 742.41 g/mol |
| Exact Mass | 740.03 |
| IUPAC Name | 4-bromo-2-fluorobenzaldehyde;methyl (E)-3-(3-aminophenyl)prop-2-enoate;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(/N=C/c2ccc(Br)cc2F)c1.COC(=O)/C=C/c1cccc(N)c1.O=Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H13BrFNO2.C10H11NO2.C7H4BrFO/c1-22-17(21)8-5-12-3-2-4-15(9-12)20-11-13-6-7-14(18)10-16(13)19;1-13-10(12)6-5-8-3-2-4-9(11)7-8;8-6-2-1-5(4-10)7(9)3-6/h2-11H,1H3;2-7H,11H2,1H3;1-4H/b8-5+,20-11+;6-5+; |
| InChIKey | CSRHNBCCYYXYTM-WZXHMKLESA-N |
| XLogP | 8.38 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.41 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|