About ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate
ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate (PubChem CID 144922152) has the molecular formula C19H18BrF2NO2
and a molecular weight of 410.26 g/mol. Its IUPAC name is ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate.
Molecular Properties
| Compound Name | ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate |
| PubChem CID | 144922152 |
| Molecular Formula | C19H18BrF2NO2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate |
| SMILES | CC.COC(=O)/C=C/c1cc(F)cc(/N=C/c2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C17H12BrF2NO2.C2H6/c1-23-17(22)5-2-11-6-14(19)9-15(7-11)21-10-12-3-4-13(18)8-16(12)20;1-2/h2-10H,1H3;1-2H3/b5-2+,21-10+; |
| InChIKey | ZNJMUDYVNOYOIO-GKDGBSPWSA-N |
| XLogP | 5.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate?
The IUPAC name of ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate (CID 144922152) is ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate.
What is the SMILES notation for ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate?
The canonical SMILES for ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate is CC.COC(=O)/C=C/c1cc(F)cc(/N=C/c2ccc(Br)cc2F)c1.
What is the InChIKey of ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate?
The InChIKey is ZNJMUDYVNOYOIO-GKDGBSPWSA-N. The full InChI is InChI=1S/C17H12BrF2NO2.C2H6/c1-23-17(22)5-2-11-6-14(19)9-15(7-11)21-10-12-3-4-13(18)8-16(12)20;1-2/h2-10H,1H3;1-2H3/b5-2+,21-10+;.
What are the key properties of ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate?
ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate has a molecular weight of 410.26 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methylideneamino]-5-fluorophenyl]prop-2-enoate is sourced from PubChem (CID 144922152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).