C23H25Cl2NO6 — CID 169425351
ethyl 3-(3-chlorophenyl)-4-nitrobutanoate;ethyl (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 169425351) has the molecular formula C23H25Cl2NO6 and a molecular weight of 482.36 g/mol. Its IUPAC name is ethyl 3-(3-chlorophenyl)-4-nitrobutanoate;ethyl (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | ethyl 3-(3-chlorophenyl)-4-nitrobutanoate;ethyl (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 169425351 |
| Molecular Formula | C23H25Cl2NO6 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | ethyl 3-(3-chlorophenyl)-4-nitrobutanoate;ethyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(Cl)c1.CCOC(=O)CC(C[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO4.C11H11ClO2/c1-2-18-12(15)7-10(8-14(16)17)9-4-3-5-11(13)6-9;1-2-14-11(13)7-6-9-4-3-5-10(12)8-9/h3-6,10H,2,7-8H2,1H3;3-8H,2H2,1H3/b;7-6+ |
| InChIKey | GFFOIYLOBYIUGR-UETGHTDLSA-N |
| XLogP | 5.57 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|