C9H13F3NO4- — CID 169430385
(2R,4S)-4-methylpiperidine-2-carboxylic acid;2,2,2-trifluoroacetate (PubChem CID 169430385) has the molecular formula C9H13F3NO4- and a molecular weight of 256.20 g/mol. Its IUPAC name is (2R,4S)-4-methylpiperidine-2-carboxylic acid;2,2,2-trifluoroacetate.
| Compound Name | (2R,4S)-4-methylpiperidine-2-carboxylic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 169430385 |
| Molecular Formula | C9H13F3NO4- |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2R,4S)-4-methylpiperidine-2-carboxylic acid;2,2,2-trifluoroacetate |
| SMILES | C[C@H]1CCN[C@@H](C(=O)O)C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H13NO2.C2HF3O2/c1-5-2-3-8-6(4-5)7(9)10;3-2(4,5)1(6)7/h5-6,8H,2-4H2,1H3,(H,9,10);(H,6,7)/p-1/t5-,6+;/m0./s1 |
| InChIKey | OHCJGSJWTLVPKM-RIHPBJNCSA-M |
| XLogP | -0.24 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |