About trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate
trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate (PubChem CID 169431812) has the molecular formula C15H26NO+
and a molecular weight of 236.38 g/mol. Its IUPAC name is trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate.
Molecular Properties
| Compound Name | trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate |
| PubChem CID | 169431812 |
| Molecular Formula | C15H26NO+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate |
| SMILES | C[N+](C)(C)CC1(c2ccccc2)CCCC1.O |
| InChI | InChI=1S/C15H24N.H2O/c1-16(2,3)13-15(11-7-8-12-15)14-9-5-4-6-10-14;/h4-6,9-10H,7-8,11-13H2,1-3H3;1H2/q+1; |
| InChIKey | RWUUQPWOQURAGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate?
The IUPAC name of trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate (CID 169431812) is trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate.
What is the SMILES notation for trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate?
The canonical SMILES for trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate is C[N+](C)(C)CC1(c2ccccc2)CCCC1.O.
What is the InChIKey of trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate?
The InChIKey is RWUUQPWOQURAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N.H2O/c1-16(2,3)13-15(11-7-8-12-15)14-9-5-4-6-10-14;/h4-6,9-10H,7-8,11-13H2,1-3H3;1H2/q+1;.
What are the key properties of trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate?
trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate has a molecular weight of 236.38 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1-phenylcyclopentyl)methyl]azanium;hydrate is sourced from PubChem (CID 169431812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).