C10H15NO — CID 169433188
4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol (PubChem CID 169433188) has the molecular formula C10H15NO and a molecular weight of 169.26 g/mol. Its IUPAC name is 4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol.
| Compound Name | 4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol |
|---|---|
| PubChem CID | 169433188 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 169.26 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | 4-(3-aminobutyl)-2,3,5,6-tetradeuteriophenol |
| SMILES | [2H]c1c([2H])c(CCC(C)N)c([2H])c([2H])c1O |
| InChI | InChI=1S/C10H15NO/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-8,12H,2-3,11H2,1H3/i4D,5D,6D,7D |
| InChIKey | WNTVTQIJPAFZEL-UGWFXTGHSA-N |
| XLogP | 1.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |