C9H12N2O3 — CID 169433357
(2S)-2-amino-1,1-dideuterio-3-(2,3,5,6-tetradeuterio-4-nitrophenyl)propan-1-ol (PubChem CID 169433357) has the molecular formula C9H12N2O3 and a molecular weight of 202.24 g/mol. Its IUPAC name is (2S)-2-amino-1,1-dideuterio-3-(2,3,5,6-tetradeuterio-4-nitrophenyl)propan-1-ol.
| Compound Name | (2S)-2-amino-1,1-dideuterio-3-(2,3,5,6-tetradeuterio-4-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 169433357 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2S)-2-amino-1,1-dideuterio-3-(2,3,5,6-tetradeuterio-4-nitrophenyl)propan-1-ol |
| SMILES | [2H]c1c([2H])c([N+](=O)[O-])c([2H])c([2H])c1C[C@H](N)C([2H])([2H])O |
| InChI | InChI=1S/C9H12N2O3/c10-8(6-12)5-7-1-3-9(4-2-7)11(13)14/h1-4,8,12H,5-6,10H2/t8-/m0/s1/i1D,2D,3D,4D,6D2 |
| InChIKey | PCLGMKWXPXAGEO-YYHFQSEXSA-N |
| XLogP | 0.46 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|