C11H21Cl3N4O2 — CID 67434643
(2S)-1-N-(2-aminoethyl)-3-(4-nitrophenyl)propane-1,2-diamine;trihydrochloride (PubChem CID 67434643) has the molecular formula C11H21Cl3N4O2 and a molecular weight of 347.67 g/mol. Its IUPAC name is (2S)-1-N-(2-aminoethyl)-3-(4-nitrophenyl)propane-1,2-diamine;trihydrochloride.
| Compound Name | (2S)-1-N-(2-aminoethyl)-3-(4-nitrophenyl)propane-1,2-diamine;trihydrochloride |
|---|---|
| PubChem CID | 67434643 |
| Molecular Formula | C11H21Cl3N4O2 |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (2S)-1-N-(2-aminoethyl)-3-(4-nitrophenyl)propane-1,2-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCNC[C@@H](N)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H18N4O2.3ClH/c12-5-6-14-8-10(13)7-9-1-3-11(4-2-9)15(16)17;;;/h1-4,10,14H,5-8,12-13H2;3*1H/t10-;;;/m0.../s1 |
| InChIKey | MRAOIDDFUXPWHI-KAFJHEIMSA-N |
| XLogP | 1.28 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|