C16H29N5O2 — CID 59068317
3-(4-nitrophenyl)-1-N-[2-[2-[propyl(tritio)amino]ethyl-tritioamino]ethyl]-1-N,2-N-ditritiopropane-1,2-diamine (PubChem CID 59068317) has the molecular formula C16H29N5O2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-N-[2-[2-[propyl(tritio)amino]ethyl-tritioamino]ethyl]-1-N,2-N-ditritiopropane-1,2-diamine.
| Compound Name | 3-(4-nitrophenyl)-1-N-[2-[2-[propyl(tritio)amino]ethyl-tritioamino]ethyl]-1-N,2-N-ditritiopropane-1,2-diamine |
|---|---|
| PubChem CID | 59068317 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 3-(4-nitrophenyl)-1-N-[2-[2-[propyl(tritio)amino]ethyl-tritioamino]ethyl]-1-N,2-N-ditritiopropane-1,2-diamine |
| SMILES | [3H]NC(Cc1ccc([N+](=O)[O-])cc1)CN([3H])CCN([3H])CCN([3H])CCC |
| InChI | InChI=1S/C16H29N5O2/c1-2-7-18-8-9-19-10-11-20-13-15(17)12-14-3-5-16(6-4-14)21(22)23/h3-6,15,18-20H,2,7-13,17H2,1H3/i/hT4 |
| InChIKey | LHFVWLQVXKEVOX-YBCMAOLYSA-N |
| XLogP | 0.64 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|