C15H33Cl2O5PSi — CID 169434384
[1-[tert-butyl(dimethyl)silyl]oxy-1,1,2,3,3,3-hexadeuteriopropan-2-yl] bis(1-chloropropan-2-yl) phosphate (PubChem CID 169434384) has the molecular formula C15H33Cl2O5PSi and a molecular weight of 429.43 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-1,1,2,3,3,3-hexadeuteriopropan-2-yl] bis(1-chloropropan-2-yl) phosphate.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-1,1,2,3,3,3-hexadeuteriopropan-2-yl] bis(1-chloropropan-2-yl) phosphate |
|---|---|
| PubChem CID | 169434384 |
| Molecular Formula | C15H33Cl2O5PSi |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-1,1,2,3,3,3-hexadeuteriopropan-2-yl] bis(1-chloropropan-2-yl) phosphate |
| SMILES | [2H]C([2H])([2H])C([2H])(OP(=O)(OC(C)CCl)OC(C)CCl)C([2H])([2H])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33Cl2O5PSi/c1-12(9-16)20-23(18,21-13(2)10-17)22-14(3)11-19-24(7,8)15(4,5)6/h12-14H,9-11H2,1-8H3/i3D3,11D2,14D |
| InChIKey | DOPGRYYAHZTZKQ-GCZSSUGRSA-N |
| XLogP | 5.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|