C17H37O5PSi — CID 23658822
(3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-di(propan-2-yloxy)phosphorylpentanal (PubChem CID 23658822) has the molecular formula C17H37O5PSi and a molecular weight of 380.54 g/mol. Its IUPAC name is (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-di(propan-2-yloxy)phosphorylpentanal.
| Compound Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-di(propan-2-yloxy)phosphorylpentanal |
|---|---|
| PubChem CID | 23658822 |
| Molecular Formula | C17H37O5PSi |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-3-di(propan-2-yloxy)phosphorylpentanal |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@@H](CC=O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H37O5PSi/c1-14(2)21-23(19,22-15(3)4)16(10-12-18)11-13-20-24(8,9)17(5,6)7/h12,14-16H,10-11,13H2,1-9H3/t16-/m0/s1 |
| InChIKey | NRYDZFKSHONVBX-INIZCTEOSA-N |
| XLogP | 5.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|