C6H14O2 — CID 169435198
2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethanol (PubChem CID 169435198) has the molecular formula C6H14O2 and a molecular weight of 127.23 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethanol.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethanol |
|---|---|
| PubChem CID | 169435198 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.16 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethanol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OCCO |
| InChI | InChI=1S/C6H14O2/c1-2-3-5-8-6-4-7/h7H,2-6H2,1H3/i1D3,2D2,3D2,5D2 |
| InChIKey | POAOYUHQDCAZBD-CIPAQKFXSA-N |
| XLogP | 0.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |