C12H20N2O2S — CID 169437444
N-[4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethyl]phenyl]methanesulfonamide (PubChem CID 169437444) has the molecular formula C12H20N2O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 169437444 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[4-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethyl]phenyl]methanesulfonamide |
| SMILES | [2H]C([2H])([2H])C([2H])(NCCc1ccc(NS(C)(=O)=O)cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H20N2O2S/c1-10(2)13-9-8-11-4-6-12(7-5-11)14-17(3,15)16/h4-7,10,13-14H,8-9H2,1-3H3/i1D3,2D3,10D |
| InChIKey | HCLCHPYEDZTGMF-SVMCCORHSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |