C22H28N2O2 — CID 169438439
1,1,2,2,2-pentadeuterioethyl (15S,17R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene-17-carboxylate (PubChem CID 169438439) has the molecular formula C22H28N2O2 and a molecular weight of 357.51 g/mol. Its IUPAC name is 1,1,2,2,2-pentadeuterioethyl (15S,17R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene-17-carboxylate.
| Compound Name | 1,1,2,2,2-pentadeuterioethyl (15S,17R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 169438439 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethyl (15S,17R,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraene-17-carboxylate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)[C@H]1C[C@]2(CC)CCCN3CCc4c(n1c1ccccc41)[C@@H]32 |
| InChI | InChI=1S/C22H28N2O2/c1-3-22-11-7-12-23-13-10-16-15-8-5-6-9-17(15)24(19(16)20(22)23)18(14-22)21(25)26-4-2/h5-6,8-9,18,20H,3-4,7,10-14H2,1-2H3/t18-,20-,22+/m1/s1/i2D3,4D2 |
| InChIKey | UJAQRLRRCXIJFW-IOSCOZGQSA-N |
| XLogP | 4.24 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |