C33H45N3O3S — CID 88808274
cyclohexyl-[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]methanamine;4-methylbenzenesulfonic acid (PubChem CID 88808274) has the molecular formula C33H45N3O3S and a molecular weight of 563.81 g/mol. Its IUPAC name is cyclohexyl-[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]methanamine;4-methylbenzenesulfonic acid.
| Compound Name | cyclohexyl-[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]methanamine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88808274 |
| Molecular Formula | C33H45N3O3S |
| Molecular Weight | 563.81 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | cyclohexyl-[(15S,19S)-15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-yl]methanamine;4-methylbenzenesulfonic acid |
| SMILES | CC[C@]12CCCN3CCc4c(n(c5ccccc45)C(C(N)C4CCCCC4)C1)[C@@H]32.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H37N3.C7H8O3S/c1-2-26-14-8-15-28-16-13-20-19-11-6-7-12-21(19)29(24(20)25(26)28)22(17-26)23(27)18-9-4-3-5-10-18;1-6-2-4-7(5-3-6)11(8,9)10/h6-7,11-12,18,22-23,25H,2-5,8-10,13-17,27H2,1H3;2-5H,1H3,(H,8,9,10)/t22?,23?,25-,26+;/m1./s1 |
| InChIKey | HTWRHPYFHHZNQC-OTQKKOLWSA-N |
| XLogP | 6.82 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.81 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|