C36H44ClO2P — CID 169438606
10-(2,5-dihydroxy-3,4-dimethylphenyl)decyl-triphenylphosphanium chloride (PubChem CID 169438606) has the molecular formula C36H44ClO2P and a molecular weight of 575.17 g/mol. Its IUPAC name is 10-(2,5-dihydroxy-3,4-dimethylphenyl)decyl-triphenylphosphanium chloride.
| Compound Name | 10-(2,5-dihydroxy-3,4-dimethylphenyl)decyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 169438606 |
| Molecular Formula | C36H44ClO2P |
| Molecular Weight | 575.17 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 10-(2,5-dihydroxy-3,4-dimethylphenyl)decyl-triphenylphosphanium chloride |
| SMILES | Cc1c(O)cc(CCCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(O)c1C.[Cl-] |
| InChI | InChI=1S/C36H43O2P.ClH/c1-29-30(2)36(38)31(28-35(29)37)20-12-7-5-3-4-6-8-19-27-39(32-21-13-9-14-22-32,33-23-15-10-16-24-33)34-25-17-11-18-26-34;/h9-11,13-18,21-26,28H,3-8,12,19-20,27H2,1-2H3,(H-,37,38);1H |
| InChIKey | CPEUFYCJJUFXIJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.17 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|