C20H18F2N3NaO5 — CID 169439334
sodium (3S,7R)-5,5-dideuterio-13-[[dideuterio-(2,4-difluorophenyl)methyl]carbamoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-olate (PubChem CID 169439334) has the molecular formula C20H18F2N3NaO5 and a molecular weight of 445.39 g/mol. Its IUPAC name is sodium (3S,7R)-5,5-dideuterio-13-[[dideuterio-(2,4-difluorophenyl)methyl]carbamoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-olate.
| Compound Name | sodium (3S,7R)-5,5-dideuterio-13-[[dideuterio-(2,4-difluorophenyl)methyl]carbamoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-olate |
|---|---|
| PubChem CID | 169439334 |
| Molecular Formula | C20H18F2N3NaO5 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | sodium (3S,7R)-5,5-dideuterio-13-[[dideuterio-(2,4-difluorophenyl)methyl]carbamoyl]-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-olate |
| SMILES | [2H]C1([2H])C[C@@H](C)N2C(=O)c3c([O-])c(=O)c(C(=O)NC([2H])([2H])c4ccc(F)cc4F)cn3C[C@@H]2O1.[Na+] |
| InChI | InChI=1S/C20H19F2N3O5.Na/c1-10-4-5-30-15-9-24-8-13(17(26)18(27)16(24)20(29)25(10)15)19(28)23-7-11-2-3-12(21)6-14(11)22;/h2-3,6,8,10,15,27H,4-5,7,9H2,1H3,(H,23,28);/q;+1/p-1/t10-,15+;/m1./s1/i5D2,7D2; |
| InChIKey | UGWJRRXTMKRYNK-OHPIXQHDSA-M |
| XLogP | -2.28 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |