C20H20F2N4O5 — CID 146558397
(2E)-N-[(2,4-difluorophenyl)methyl]-2-hydroxyimino-2-[(9S,13R)-4-hydroxy-13-methyl-2-oxo-10-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-3,5-dien-5-yl]acetamide (PubChem CID 146558397) has the molecular formula C20H20F2N4O5 and a molecular weight of 434.40 g/mol. Its IUPAC name is (2E)-N-[(2,4-difluorophenyl)methyl]-2-hydroxyimino-2-[(9S,13R)-4-hydroxy-13-methyl-2-oxo-10-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-3,5-dien-5-yl]acetamide.
| Compound Name | (2E)-N-[(2,4-difluorophenyl)methyl]-2-hydroxyimino-2-[(9S,13R)-4-hydroxy-13-methyl-2-oxo-10-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-3,5-dien-5-yl]acetamide |
|---|---|
| PubChem CID | 146558397 |
| Molecular Formula | C20H20F2N4O5 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2E)-N-[(2,4-difluorophenyl)methyl]-2-hydroxyimino-2-[(9S,13R)-4-hydroxy-13-methyl-2-oxo-10-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-3,5-dien-5-yl]acetamide |
| SMILES | C[C@@H]1CCO[C@H]2Cn3cc(/C(=N\O)C(=O)NCc4ccc(F)cc4F)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C20H20F2N4O5/c1-10-4-5-31-15-9-25-8-13(18(27)17(25)20(29)26(10)15)16(24-30)19(28)23-7-11-2-3-12(21)6-14(11)22/h2-3,6,8,10,15,27,30H,4-5,7,9H2,1H3,(H,23,28)/b24-16+/t10-,15+/m1/s1 |
| InChIKey | BKCROOGUYMPPTA-AQTRXGJESA-N |
| XLogP | 1.56 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|