C24H30N2O4 — CID 169439438
3-[4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-7-methoxy-2-methylisoquinolin-1-one (PubChem CID 169439438) has the molecular formula C24H30N2O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-[4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-7-methoxy-2-methylisoquinolin-1-one.
| Compound Name | 3-[4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-7-methoxy-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 169439438 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 3-[4-[3-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-2-hydroxypropoxy]phenyl]-7-methoxy-2-methylisoquinolin-1-one |
| SMILES | [2H]C([2H])([2H])C(NCC(O)COc1ccc(-c2cc3ccc(OC)cc3c(=O)n2C)cc1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H30N2O4/c1-24(2,3)25-14-18(27)15-30-19-9-6-16(7-10-19)22-12-17-8-11-20(29-5)13-21(17)23(28)26(22)4/h6-13,18,25,27H,14-15H2,1-5H3/i1D3,2D3,3D3 |
| InChIKey | MZELTXWHFDTAOO-GQALSZNTSA-N |
| XLogP | 3.34 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |