C30H36ClN3O3 — CID 70618612
7-methoxy-2-methyl-3-[4-[3-[3-(3-methylanilino)propylamino]propoxy]phenyl]isoquinolin-1-one;hydrochloride (PubChem CID 70618612) has the molecular formula C30H36ClN3O3 and a molecular weight of 522.09 g/mol. Its IUPAC name is 7-methoxy-2-methyl-3-[4-[3-[3-(3-methylanilino)propylamino]propoxy]phenyl]isoquinolin-1-one;hydrochloride.
| Compound Name | 7-methoxy-2-methyl-3-[4-[3-[3-(3-methylanilino)propylamino]propoxy]phenyl]isoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 70618612 |
| Molecular Formula | C30H36ClN3O3 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 7-methoxy-2-methyl-3-[4-[3-[3-(3-methylanilino)propylamino]propoxy]phenyl]isoquinolin-1-one;hydrochloride |
| SMILES | COc1ccc2cc(-c3ccc(OCCCNCCCNc4cccc(C)c4)cc3)n(C)c(=O)c2c1.Cl |
| InChI | InChI=1S/C30H35N3O3.ClH/c1-22-7-4-8-25(19-22)32-17-5-15-31-16-6-18-36-26-12-9-23(10-13-26)29-20-24-11-14-27(35-3)21-28(24)30(34)33(29)2;/h4,7-14,19-21,31-32H,5-6,15-18H2,1-3H3;1H |
| InChIKey | XTNQMYKYANLJQJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|