C14H14N2O8S2 — CID 169449323
8-[(2-methoxy-3-pyridinyl)sulfamoyl]-2,3-dihydro-1,4-benzodioxine-5-sulfonic acid (PubChem CID 169449323) has the molecular formula C14H14N2O8S2 and a molecular weight of 402.41 g/mol. Its IUPAC name is 8-[(2-methoxy-3-pyridinyl)sulfamoyl]-2,3-dihydro-1,4-benzodioxine-5-sulfonic acid.
| Compound Name | 8-[(2-methoxy-3-pyridinyl)sulfamoyl]-2,3-dihydro-1,4-benzodioxine-5-sulfonic acid |
|---|---|
| PubChem CID | 169449323 |
| Molecular Formula | C14H14N2O8S2 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 8-[(2-methoxy-3-pyridinyl)sulfamoyl]-2,3-dihydro-1,4-benzodioxine-5-sulfonic acid |
| SMILES | COc1ncccc1NS(=O)(=O)c1ccc(S(=O)(=O)O)c2c1OCCO2 |
| InChI | InChI=1S/C14H14N2O8S2/c1-22-14-9(3-2-6-15-14)16-25(17,18)10-4-5-11(26(19,20)21)13-12(10)23-7-8-24-13/h2-6,16H,7-8H2,1H3,(H,19,20,21) |
| InChIKey | FLARYIYXQGJMBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|