C32H32N2O3 — CID 169449646
N,N-dibenzyl-2-[2-(dibenzylamino)-2-oxoethoxy]acetamide (PubChem CID 169449646) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is N,N-dibenzyl-2-[2-(dibenzylamino)-2-oxoethoxy]acetamide.
| Compound Name | N,N-dibenzyl-2-[2-(dibenzylamino)-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 169449646 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N,N-dibenzyl-2-[2-(dibenzylamino)-2-oxoethoxy]acetamide |
| SMILES | O=C(COCC(=O)N(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H32N2O3/c35-31(33(21-27-13-5-1-6-14-27)22-28-15-7-2-8-16-28)25-37-26-32(36)34(23-29-17-9-3-10-18-29)24-30-19-11-4-12-20-30/h1-20H,21-26H2 |
| InChIKey | VZSLDEPHWUKRRW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |