C14H16N2O5 — CID 169451299
N-[3-(1-hydroxyethyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide (PubChem CID 169451299) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is N-[3-(1-hydroxyethyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-(1-hydroxyethyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 169451299 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-[3-(1-hydroxyethyl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cc(C(C)O)no1 |
| InChI | InChI=1S/C14H16N2O5/c1-8(17)9-7-12(21-16-9)15-14(18)13-10(19-2)5-4-6-11(13)20-3/h4-8,17H,1-3H3,(H,15,18) |
| InChIKey | PRQLMPOGGRAGCK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |