C21H29ClN2O4 — CID 19911973
N-[3-(7-chloro-3-ethylheptan-3-yl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide (PubChem CID 19911973) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[3-(7-chloro-3-ethylheptan-3-yl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-(7-chloro-3-ethylheptan-3-yl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19911973 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[3-(7-chloro-3-ethylheptan-3-yl)-1,2-oxazol-5-yl]-2,6-dimethoxybenzamide |
| SMILES | CCC(CC)(CCCCCl)c1cc(NC(=O)c2c(OC)cccc2OC)on1 |
| InChI | InChI=1S/C21H29ClN2O4/c1-5-21(6-2,12-7-8-13-22)17-14-18(28-24-17)23-20(25)19-15(26-3)10-9-11-16(19)27-4/h9-11,14H,5-8,12-13H2,1-4H3,(H,23,25) |
| InChIKey | BBSMYLSXNGIXOS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|