C18H29F3N2O4 — CID 58297243
7,7,7-trifluoro-N-[3-[2-(2-methoxyethoxy)propan-2-yl]-1,2-oxazol-5-yl]-2,2-dimethylheptanamide (PubChem CID 58297243) has the molecular formula C18H29F3N2O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 7,7,7-trifluoro-N-[3-[2-(2-methoxyethoxy)propan-2-yl]-1,2-oxazol-5-yl]-2,2-dimethylheptanamide.
| Compound Name | 7,7,7-trifluoro-N-[3-[2-(2-methoxyethoxy)propan-2-yl]-1,2-oxazol-5-yl]-2,2-dimethylheptanamide |
|---|---|
| PubChem CID | 58297243 |
| Molecular Formula | C18H29F3N2O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 7,7,7-trifluoro-N-[3-[2-(2-methoxyethoxy)propan-2-yl]-1,2-oxazol-5-yl]-2,2-dimethylheptanamide |
| SMILES | COCCOC(C)(C)c1cc(NC(=O)C(C)(C)CCCCC(F)(F)F)on1 |
| InChI | InChI=1S/C18H29F3N2O4/c1-16(2,8-6-7-9-18(19,20)21)15(24)22-14-12-13(23-27-14)17(3,4)26-11-10-25-5/h12H,6-11H2,1-5H3,(H,22,24) |
| InChIKey | ILPDVJXBPOVZFQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|