About phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate
phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate (PubChem CID 123365476) has the molecular formula C14H15FN2O3
and a molecular weight of 278.28 g/mol. Its IUPAC name is phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate |
| PubChem CID | 123365476 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate |
| SMILES | CC(C)(CF)c1cc(NC(=O)Oc2ccccc2)on1 |
| InChI | InChI=1S/C14H15FN2O3/c1-14(2,9-15)11-8-12(20-17-11)16-13(18)19-10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,16,18) |
| InChIKey | XVMCPHGQKOVCFX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate?
The IUPAC name of phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate (CID 123365476) is phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate.
What is the SMILES notation for phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate?
The canonical SMILES for phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate is CC(C)(CF)c1cc(NC(=O)Oc2ccccc2)on1.
What is the InChIKey of phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate?
The InChIKey is XVMCPHGQKOVCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2O3/c1-14(2,9-15)11-8-12(20-17-11)16-13(18)19-10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,16,18).
What are the key properties of phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate?
phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate has a molecular weight of 278.28 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[3-(1-fluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]carbamate is sourced from PubChem (CID 123365476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).