C27H28N2O4Si — CID 170545487
phenyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazol-5-yl]carbamate (PubChem CID 170545487) has the molecular formula C27H28N2O4Si and a molecular weight of 472.62 g/mol. Its IUPAC name is phenyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazol-5-yl]carbamate.
| Compound Name | phenyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazol-5-yl]carbamate |
|---|---|
| PubChem CID | 170545487 |
| Molecular Formula | C27H28N2O4Si |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | phenyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-oxazol-5-yl]carbamate |
| SMILES | CC(C)(C)[Si](OCc1cc(NC(=O)Oc2ccccc2)on1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4Si/c1-27(2,3)34(23-15-9-5-10-16-23,24-17-11-6-12-18-24)31-20-21-19-25(33-29-21)28-26(30)32-22-13-7-4-8-14-22/h4-19H,20H2,1-3H3,(H,28,30) |
| InChIKey | CSYNRGIYZGRPIO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|