C13H25FN2O2 — CID 170582956
ethane;N-[3-(2-fluoropropan-2-yl)-1,2-oxazol-5-yl]propanamide (PubChem CID 170582956) has the molecular formula C13H25FN2O2 and a molecular weight of 260.35 g/mol. Its IUPAC name is ethane;N-[3-(2-fluoropropan-2-yl)-1,2-oxazol-5-yl]propanamide.
| Compound Name | ethane;N-[3-(2-fluoropropan-2-yl)-1,2-oxazol-5-yl]propanamide |
|---|---|
| PubChem CID | 170582956 |
| Molecular Formula | C13H25FN2O2 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | ethane;N-[3-(2-fluoropropan-2-yl)-1,2-oxazol-5-yl]propanamide |
| SMILES | CC.CC.CCC(=O)Nc1cc(C(C)(C)F)no1 |
| InChI | InChI=1S/C9H13FN2O2.2C2H6/c1-4-7(13)11-8-5-6(12-14-8)9(2,3)10;2*1-2/h5H,4H2,1-3H3,(H,11,13);2*1-2H3 |
| InChIKey | RAJSJHDBWRZKCB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |