C9H11F3N2O2 — CID 176873409
3-methyl-N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]butanamide (PubChem CID 176873409) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 3-methyl-N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]butanamide.
| Compound Name | 3-methyl-N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]butanamide |
|---|---|
| PubChem CID | 176873409 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-methyl-N-[3-(trifluoromethyl)-1,2-oxazol-5-yl]butanamide |
| SMILES | CC(C)CC(=O)Nc1cc(C(F)(F)F)no1 |
| InChI | InChI=1S/C9H11F3N2O2/c1-5(2)3-7(15)13-8-4-6(14-16-8)9(10,11)12/h4-5H,3H2,1-2H3,(H,13,15) |
| InChIKey | FWAWNYNCBMZPGG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |