C14H15F3N4O2 — CID 51107856
1-[[4-(dimethylamino)phenyl]methyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea (PubChem CID 51107856) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
|---|---|
| PubChem CID | 51107856 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[3-(trifluoromethyl)-1,2-oxazol-5-yl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)Nc2cc(C(F)(F)F)no2)cc1 |
| InChI | InChI=1S/C14H15F3N4O2/c1-21(2)10-5-3-9(4-6-10)8-18-13(22)19-12-7-11(20-23-12)14(15,16)17/h3-7H,8H2,1-2H3,(H2,18,19,22) |
| InChIKey | HZODVMIABAKNBK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|