C23H34F6N2O8S2 — CID 59253223
[2-methyl-2-[5-[[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoyl]amino]-1,2-oxazol-3-yl]propyl] 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate (PubChem CID 59253223) has the molecular formula C23H34F6N2O8S2 and a molecular weight of 644.65 g/mol. Its IUPAC name is [2-methyl-2-[5-[[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoyl]amino]-1,2-oxazol-3-yl]propyl] 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate.
| Compound Name | [2-methyl-2-[5-[[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoyl]amino]-1,2-oxazol-3-yl]propyl] 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate |
|---|---|
| PubChem CID | 59253223 |
| Molecular Formula | C23H34F6N2O8S2 |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [2-methyl-2-[5-[[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoyl]amino]-1,2-oxazol-3-yl]propyl] 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propanoate |
| SMILES | CC(C)(COC(=O)C(C)(C)S(=O)(=O)CCCC(F)(F)F)c1cc(NC(=O)C(C)(C)S(=O)(=O)CCCC(F)(F)F)on1 |
| InChI | InChI=1S/C23H34F6N2O8S2/c1-19(2,14-38-18(33)21(5,6)41(36,37)12-8-10-23(27,28)29)15-13-16(39-31-15)30-17(32)20(3,4)40(34,35)11-7-9-22(24,25)26/h13H,7-12,14H2,1-6H3,(H,30,32) |
| InChIKey | QQTSORSBBCMXDD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |