C15H26F3N3O3S — CID 118486682
1-(3-tert-butyl-1,2-oxazol-5-yl)-2-[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propyl]hydrazine (PubChem CID 118486682) has the molecular formula C15H26F3N3O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-2-[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propyl]hydrazine.
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-2-[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propyl]hydrazine |
|---|---|
| PubChem CID | 118486682 |
| Molecular Formula | C15H26F3N3O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-2-[2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propyl]hydrazine |
| SMILES | CC(C)(C)c1cc(NNCC(C)(C)S(=O)(=O)CCCC(F)(F)F)on1 |
| InChI | InChI=1S/C15H26F3N3O3S/c1-13(2,3)11-9-12(24-21-11)20-19-10-14(4,5)25(22,23)8-6-7-15(16,17)18/h9,19-20H,6-8,10H2,1-5H3 |
| InChIKey | UAIXMHRYSOKCMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|