C8H13ClN2O3S — CID 63665551
N-(3-tert-butyl-1,2-oxazol-5-yl)-1-chloromethanesulfonamide (PubChem CID 63665551) has the molecular formula C8H13ClN2O3S and a molecular weight of 252.72 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-1-chloromethanesulfonamide.
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-1-chloromethanesulfonamide |
|---|---|
| PubChem CID | 63665551 |
| Molecular Formula | C8H13ClN2O3S |
| Molecular Weight | 252.72 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-1-chloromethanesulfonamide |
| SMILES | CC(C)(C)c1cc(NS(=O)(=O)CCl)on1 |
| InChI | InChI=1S/C8H13ClN2O3S/c1-8(2,3)6-4-7(14-10-6)11-15(12,13)5-9/h4,11H,5H2,1-3H3 |
| InChIKey | MRLAAIFQKUCRAB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|