C16H20N2O5S — CID 2121635
ethyl 4-[(3-tert-butyl-1,2-oxazol-5-yl)sulfamoyl]benzoate (PubChem CID 2121635) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 4-[(3-tert-butyl-1,2-oxazol-5-yl)sulfamoyl]benzoate.
| Compound Name | ethyl 4-[(3-tert-butyl-1,2-oxazol-5-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2121635 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 4-[(3-tert-butyl-1,2-oxazol-5-yl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2cc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-5-22-15(19)11-6-8-12(9-7-11)24(20,21)18-14-10-13(17-23-14)16(2,3)4/h6-10,18H,5H2,1-4H3 |
| InChIKey | YXRRWACWBWWSJL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |