C16H17N3O6 — CID 7603828
[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 7603828) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7603828 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | CC(C)(C)c1cc(NC(=O)COC(=O)c2ccc([N+](=O)[O-])cc2)on1 |
| InChI | InChI=1S/C16H17N3O6/c1-16(2,3)12-8-14(25-18-12)17-13(20)9-24-15(21)10-4-6-11(7-5-10)19(22)23/h4-8H,9H2,1-3H3,(H,17,20) |
| InChIKey | RLKOXACVVITRSF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|