C23H23N3O5 — CID 7630533
[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 7630533) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 7630533 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | CC(C)(C)c1cc(NC(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)on1 |
| InChI | InChI=1S/C23H23N3O5/c1-23(2,3)18-13-20(31-26-18)25-19(27)14-30-22(29)16-11-7-8-12-17(16)24-21(28)15-9-5-4-6-10-15/h4-13H,14H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | OAXLUCWMCXWPLQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |